{Bis[2-(diphenylphosphino)ethyl]phenylphosphine-κ³P,P′,P′′}chloridopalladium(II) hexafluoridophosphate

Abstract

In the title compound, [PdCl(C34H33P3)]PF6, the PdII atom adopts a distorted PdP3Cl square-planar geometry arising from the P,P′,P′′-tridentate triphos ligand and a chloride ion.

Formation and structures of palladium-cyanomethyl complexes generated under unexpectedly mild conditions: quantifying the acidification of acetonitrile coordinated to a palladium center

“…These distances are also very similar to the Pd-Pterminal distances in [Pd(triphos)X] + complexes with X = Cl, Br, I, NO3, O3SCF3, and N-p-tosyl, all of which range from 2.31-2.34 Å. 23,[25][26][27][28][29][30][31] It is clear that there is no significant cis influence due to the cyanomethyl or any other X ligand. On the other hand, while the Pd-P1 distances in the known [Pd(triphos)X] + complexes are all between 2.19-2.21 Å, indicating that the trans influences of these weak-field ions are all similar, the Pd-P1 distance in 1 is significantly longer, at 2.269(2) Å.…”

“…The palladium complex has an overall distorted square planar structure similar to other [Pd(triphos)X] + cations that have been crystallographically characterized. 23,[25][26][27][28][29][30][31] There is crystallographically-imposed mirror symmetry, matching the symmetry observed in solution but rare for solid-state structures of [M(triphos)X] complexes, which usually crystallize in chiral conformations due to the arrangements of the five-membered chelate rings. The chelate bite angle is 83.73(4)°, which is very similar to the aforementioned [Pd(triphos)X] + cations but somewhat smaller than the [Pd(RP[CH2CH2PR2])(NCCH3)] 2+ complexes that have been structurally characterized;…”