Unusual rearrangement of the Ru3(~-CO)z(CO)6{~3-rl l:rl I:rl4:rl4-C4Phz(CH=CHPh)z} complex containing an open triruthenium framework to the Ru3-triangular cluster Ru3(CO)8{~t3-qJ:rlI:q4:qZ-C4Ph2(CH=CHPh)z}. Reactions of Ru3(CO)8{I.t3-ql:ql:q4:qz-C4Phx(CH=CHPh)x} with PPh3, P(OPri)3, CO, and the crystal structure of Ru3(CO)8(PPh3){P-rll:rll:r 14_ CaPhx(CH=CHPh)2}Complex Ru](p,-CO)2(CO)6{t.t3-qI:qI:rl4:rl4-C4Ph2(CH=CHPh)2} containing an open triruthenium framework undergoes rearrangement to the Ru3-triangular Ru3(CO)8{~ 3-qJ:qI:rln:q2-C4Ph2(CH=CHPh)2} cluster when heated in refluxing hexane. Reactions of the latter complex with PPh3, P(OPri)3, and CO wcre studied. The structure of one of the reaction products, the Ruj(CO)g(PPh3){~t-rlI:qI:rl4-C4Ph2(CH=CHPh)2} cluster, was established by X-ray structural analysis.